![Manganese(3+) chloride 2,2'-{1,2-ethanediylbis[nitrilo(E)methylylidene]}diphenolate (1:1:1) (CAS: 53177-12-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0686832.png "Manganese(3+) chloride 2,2'-{1,2-ethanediylbis[nitrilo(E)methylylidene]}diphenolate (1:1:1) chemical structure")
Manganese(3+) chloride 2,2'-{1,2-ethanediylbis[nitrilo(E)methylylidene]}diphenolate (1:1:1)
Catalog No: FT-0686832
CAS No: 53177-12-1
- Chemical Name: Manganese(3+) chloride 2,2'-{1,2-ethanediylbis[nitrilo(E)methylylidene]}diphenolate (1:1:1)
- Molecular Formula: C16H14ClMnN2O2
- Molecular Weight: 356.68
- InChI Key: HBQGFROGWOHBAG-UHFFFAOYSA-K
- InChI: InChI=1S/C16H16N2O2.ClH.Mn/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;;/h1-8,11-12,19-20H,9-10H2;1H;/q;;+3/p-3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | manganese(3+),2-[2-[(2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate,chloride |
|---|---|
| Flash_Point: | 294.1ºC |
| Melting_Point: | N/A |
| FW: | 356.686 |
| Density: | N/A |
| CAS: | 53177-12-1 |
| Bolling_Point: | 448.8ºC at 760mmHg |
| MF: | C16H14ClMnN2O2 |
| LogP: | 0.51620 |
|---|---|
| Flash_Point: | 294.1ºC |
| FW: | 356.686 |
| PSA: | 70.84000 |
| MF: | C16H14ClMnN2O2 |
| Bolling_Point: | 448.8ºC at 760mmHg |
| Exact_Mass: | 356.012421 |
| RIDADR: | NONH for all modes of transport |
|---|
